C16H21F2N5O2Si — CID 123580474
(5R)-5-(azidomethyl)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 123580474) has the molecular formula C16H21F2N5O2Si and a molecular weight of 381.46 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123580474 |
| Molecular Formula | C16H21F2N5O2Si |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[4-(4,4-dimethyl-1,4-azasilinan-1-yl)-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si]1(C)CCN(c2c(F)cc(N3C[C@H](CN=[N+]=[N-])OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C16H21F2N5O2Si/c1-26(2)5-3-22(4-6-26)15-13(17)7-11(8-14(15)18)23-10-12(9-20-21-19)25-16(23)24/h7-8,12H,3-6,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | VFHXYGMDLHAGMN-LBPRGKRZSA-N |
| XLogP | 4.13 |
| TPSA | 81.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|