C15H15F2N5O2S — CID 166925762
5-(azidomethyl)-3-[3,5-difluoro-4-(2-thia-7-azabicyclo[2.2.1]heptan-7-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 166925762) has the molecular formula C15H15F2N5O2S and a molecular weight of 367.38 g/mol. Its IUPAC name is 5-(azidomethyl)-3-[3,5-difluoro-4-(2-thia-7-azabicyclo[2.2.1]heptan-7-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-[3,5-difluoro-4-(2-thia-7-azabicyclo[2.2.1]heptan-7-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166925762 |
| Molecular Formula | C15H15F2N5O2S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-(azidomethyl)-3-[3,5-difluoro-4-(2-thia-7-azabicyclo[2.2.1]heptan-7-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CN(c2cc(F)c(N3C4CCC3SC4)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H15F2N5O2S/c16-11-3-9(21-6-10(5-19-20-18)24-15(21)23)4-12(17)14(11)22-8-1-2-13(22)25-7-8/h3-4,8,10,13H,1-2,5-7H2 |
| InChIKey | HLZDIPIABKQECK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|