C20H23F2N5O2S — CID 155319477
(5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 155319477) has the molecular formula C20H23F2N5O2S and a molecular weight of 435.50 g/mol. Its IUPAC name is (5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 155319477 |
| Molecular Formula | C20H23F2N5O2S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (5R)-3-[4-(1,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-c]pyrrol-2-yl)-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1cc(F)c(N2CC3CCSCCC3C2)c(F)c1 |
| InChI | InChI=1S/C20H23F2N5O2S/c21-17-7-15(27-12-16(29-20(27)28)11-26-4-3-23-24-26)8-18(22)19(17)25-9-13-1-5-30-6-2-14(13)10-25/h3-4,7-8,13-14,16H,1-2,5-6,9-12H2/t13?,14?,16-/m0/s1 |
| InChIKey | RWULYRQCLPBPDH-XUJLQICISA-N |
| XLogP | 3.16 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|