C17H16N4O2S — CID 59120535
(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 59120535) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59120535 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](CNc4nccs4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H16N4O2S/c1-18-17(6-7-17)12-2-4-13(5-3-12)21-11-14(23-16(21)22)10-20-15-19-8-9-24-15/h2-5,8-9,14H,6-7,10-11H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | BTEIPAPVOKYAIC-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|