C17H17FN6O3S — CID 76734392
4-[2-fluoro-4-[2-oxo-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde (PubChem CID 76734392) has the molecular formula C17H17FN6O3S and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[2-fluoro-4-[2-oxo-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde.
| Compound Name | 4-[2-fluoro-4-[2-oxo-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 76734392 |
| Molecular Formula | C17H17FN6O3S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[2-fluoro-4-[2-oxo-5-[(1,3-thiazol-2-ylamino)methyl]-1,3-oxazolidin-3-yl]phenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2ccc(N3CC(CNc4nccs4)OC3=O)cc2F)C=N1 |
| InChI | InChI=1S/C17H17FN6O3S/c18-14-7-12(1-2-15(14)22-4-5-23(11-25)21-10-22)24-9-13(27-17(24)26)8-20-16-19-3-6-28-16/h1-3,6-7,10-11,13H,4-5,8-9H2,(H,19,20) |
| InChIKey | RMPMBSKKYUCROF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|