C17H22FN7O4 — CID 89083060
1-amino-1-ethyl-3-[[(5S)-3-[3-fluoro-4-(1-formyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea (PubChem CID 89083060) has the molecular formula C17H22FN7O4 and a molecular weight of 407.41 g/mol. Its IUPAC name is 1-amino-1-ethyl-3-[[(5S)-3-[3-fluoro-4-(1-formyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea.
| Compound Name | 1-amino-1-ethyl-3-[[(5S)-3-[3-fluoro-4-(1-formyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea |
|---|---|
| PubChem CID | 89083060 |
| Molecular Formula | C17H22FN7O4 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-amino-1-ethyl-3-[[(5S)-3-[3-fluoro-4-(1-formyl-5,6-dihydro-1,2,4-triazin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]urea |
| SMILES | CCN(N)C(=O)NC[C@H]1CN(c2ccc(N3C=NN(C=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H22FN7O4/c1-2-25(19)16(27)20-8-13-9-24(17(28)29-13)12-3-4-15(14(18)7-12)22-5-6-23(11-26)21-10-22/h3-4,7,10-11,13H,2,5-6,8-9,19H2,1H3,(H,20,27)/t13-/m0/s1 |
| InChIKey | ZCPDGRRYMTUKRE-ZDUSSCGKSA-N |
| XLogP | 0.28 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|