C17H17F3N4O4 — CID 58361761
4-[4-[(5S)-5-(4,4-difluoro-3-oxobutyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde (PubChem CID 58361761) has the molecular formula C17H17F3N4O4 and a molecular weight of 398.34 g/mol. Its IUPAC name is 4-[4-[(5S)-5-(4,4-difluoro-3-oxobutyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde.
| Compound Name | 4-[4-[(5S)-5-(4,4-difluoro-3-oxobutyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 58361761 |
| Molecular Formula | C17H17F3N4O4 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[4-[(5S)-5-(4,4-difluoro-3-oxobutyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-5,6-dihydro-1,2,4-triazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2ccc(N3C[C@H](CCC(=O)C(F)F)OC3=O)cc2F)C=N1 |
| InChI | InChI=1S/C17H17F3N4O4/c18-13-7-11(1-3-14(13)22-5-6-23(10-25)21-9-22)24-8-12(28-17(24)27)2-4-15(26)16(19)20/h1,3,7,9-10,12,16H,2,4-6,8H2/t12-/m0/s1 |
| InChIKey | MKDBFZYRCDOUDP-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|