C19H17N5O3 — CID 20616720
N-[[3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazine-2-carboxamide (PubChem CID 20616720) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is N-[[3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 20616720 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[[3-[4-(1-isocyanocyclopropyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazine-2-carboxamide |
| SMILES | [C-]#[N+]C1(c2ccc(N3CC(CNC(=O)c4cnccn4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H17N5O3/c1-20-19(6-7-19)13-2-4-14(5-3-13)24-12-15(27-18(24)26)10-23-17(25)16-11-21-8-9-22-16/h2-5,8-9,11,15H,6-7,10,12H2,(H,23,25) |
| InChIKey | NAFALFVOEIPKFX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|