C17H16N4O3 — CID 59120560
(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 59120560) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59120560 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(1,2-oxazol-3-ylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](CNc4ccon4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H16N4O3/c1-18-17(7-8-17)12-2-4-13(5-3-12)21-11-14(24-16(21)22)10-19-15-6-9-23-20-15/h2-6,9,14H,7-8,10-11H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | LSWYLAADWWMHOE-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|