C19H18N4O2 — CID 59120531
(5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(pyridin-2-ylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 59120531) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(pyridin-2-ylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(pyridin-2-ylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59120531 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (5S)-3-[4-(1-isocyanocyclopropyl)phenyl]-5-[(pyridin-2-ylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](CNc4ccccn4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H18N4O2/c1-20-19(9-10-19)14-5-7-15(8-6-14)23-13-16(25-18(23)24)12-22-17-4-2-3-11-21-17/h2-8,11,16H,9-10,12-13H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | VCEOJDHHWGDSSQ-INIZCTEOSA-N |
| XLogP | 3.43 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|