C17H16FN3O3 — CID 110327677
1-[[3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylurea (PubChem CID 110327677) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is 1-[[3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 110327677 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[[3-(3-fluorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylurea |
| SMILES | O=C(NCC1CN(c2cccc(F)c2)C(=O)O1)Nc1ccccc1 |
| InChI | InChI=1S/C17H16FN3O3/c18-12-5-4-8-14(9-12)21-11-15(24-17(21)23)10-19-16(22)20-13-6-2-1-3-7-13/h1-9,15H,10-11H2,(H2,19,20,22) |
| InChIKey | CSHUQJUBJQIFQG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |