C14H17N3O3 — CID 110315593
1-[(3-cyclopropyl-2-oxo-1,3-oxazolidin-5-yl)methyl]-3-phenylurea (PubChem CID 110315593) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-[(3-cyclopropyl-2-oxo-1,3-oxazolidin-5-yl)methyl]-3-phenylurea.
| Compound Name | 1-[(3-cyclopropyl-2-oxo-1,3-oxazolidin-5-yl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 110315593 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-[(3-cyclopropyl-2-oxo-1,3-oxazolidin-5-yl)methyl]-3-phenylurea |
| SMILES | O=C(NCC1CN(C2CC2)C(=O)O1)Nc1ccccc1 |
| InChI | InChI=1S/C14H17N3O3/c18-13(16-10-4-2-1-3-5-10)15-8-12-9-17(11-6-7-11)14(19)20-12/h1-5,11-12H,6-9H2,(H2,15,16,18) |
| InChIKey | RZOOWJHNYBXQAW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |