C17H16ClN3O3 — CID 16922883
1-(4-chlorophenyl)-3-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]urea (PubChem CID 16922883) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]urea |
|---|---|
| PubChem CID | 16922883 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2-oxo-3-phenyl-1,3-oxazolidin-5-yl)methyl]urea |
| SMILES | O=C(NCC1CN(c2ccccc2)C(=O)O1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-12-6-8-13(9-7-12)20-16(22)19-10-15-11-21(17(23)24-15)14-4-2-1-3-5-14/h1-9,15H,10-11H2,(H2,19,20,22) |
| InChIKey | UAHMTPNMQXWHRO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |