C14H19N3O2S — CID 139799570
1-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]-3-propylthiourea (PubChem CID 139799570) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]-3-propylthiourea.
| Compound Name | 1-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 139799570 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-[[(5S)-2-oxo-3-phenyl-1,3-oxazolidin-5-yl]methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NC[C@H]1CN(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C14H19N3O2S/c1-2-8-15-13(20)16-9-12-10-17(14(18)19-12)11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H2,15,16,20)/t12-/m0/s1 |
| InChIKey | AYRJJFWCNIUOJG-LBPRGKRZSA-N |
| XLogP | 1.89 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|