C13H14N6O2S — CID 87951002
[(5S)-2-oxo-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,3-oxazolidin-5-yl]methylthiourea (PubChem CID 87951002) has the molecular formula C13H14N6O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is [(5S)-2-oxo-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,3-oxazolidin-5-yl]methylthiourea.
| Compound Name | [(5S)-2-oxo-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,3-oxazolidin-5-yl]methylthiourea |
|---|---|
| PubChem CID | 87951002 |
| Molecular Formula | C13H14N6O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [(5S)-2-oxo-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,3-oxazolidin-5-yl]methylthiourea |
| SMILES | NC(=S)NC[C@H]1CN(c2ccc(-n3cncn3)cc2)C(=O)O1 |
| InChI | InChI=1S/C13H14N6O2S/c14-12(22)16-5-11-6-18(13(20)21-11)9-1-3-10(4-2-9)19-8-15-7-17-19/h1-4,7-8,11H,5-6H2,(H3,14,16,22)/t11-/m0/s1 |
| InChIKey | INLSMIZFVBPRNN-NSHDSACASA-N |
| XLogP | 0.43 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|