C14H16N4O4S — CID 91285612
5-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,3-dihydroindole-1-carboxylic acid (PubChem CID 91285612) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 5-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 5-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 91285612 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2,3-dihydroindole-1-carboxylic acid |
| SMILES | NC(=S)NC[C@H]1CN(c2ccc3c(c2)CCN3C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C14H16N4O4S/c15-12(23)16-6-10-7-18(14(21)22-10)9-1-2-11-8(5-9)3-4-17(11)13(19)20/h1-2,5,10H,3-4,6-7H2,(H,19,20)(H3,15,16,23)/t10-/m0/s1 |
| InChIKey | LKLODLUISLWZCT-JTQLQIEISA-N |
| XLogP | 0.89 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|