C18H22F4N4O5 — CID 76699270
N-[[3-[3,5-difluoro-4-[2-(2-hydroxyethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 76699270) has the molecular formula C18H22F4N4O5 and a molecular weight of 450.39 g/mol. Its IUPAC name is N-[[3-[3,5-difluoro-4-[2-(2-hydroxyethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | N-[[3-[3,5-difluoro-4-[2-(2-hydroxyethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 76699270 |
| Molecular Formula | C18H22F4N4O5 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[[3-[3,5-difluoro-4-[2-(2-hydroxyethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCC1CN(c2cc(F)c(N3CCON(CCO)CC3)c(F)c2)C(=O)O1)C(F)F |
| InChI | InChI=1S/C18H22F4N4O5/c19-13-7-11(26-10-12(31-18(26)29)9-23-17(28)16(21)22)8-14(20)15(13)24-1-2-25(3-5-27)30-6-4-24/h7-8,12,16,27H,1-6,9-10H2,(H,23,28) |
| InChIKey | HJEUISSHAOEDJV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|