C23H28F3N5O4 — CID 163490026
2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[(4-methyl-3,4-dihydropyridin-5-yl)methyl]-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 163490026) has the molecular formula C23H28F3N5O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[(4-methyl-3,4-dihydropyridin-5-yl)methyl]-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[(4-methyl-3,4-dihydropyridin-5-yl)methyl]-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 163490026 |
| Molecular Formula | C23H28F3N5O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[(4-methyl-3,4-dihydropyridin-5-yl)methyl]-1,2,5-oxadiazepan-5-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC1CC=NC=C1CN1CCN(c2ccc(N3C[C@H](CNC(=O)C(F)F)OC3=O)cc2F)CCO1 |
| InChI | InChI=1S/C23H28F3N5O4/c1-15-4-5-27-11-16(15)13-30-7-6-29(8-9-34-30)20-3-2-17(10-19(20)24)31-14-18(35-23(31)33)12-28-22(32)21(25)26/h2-3,5,10-11,15,18,21H,4,6-9,12-14H2,1H3,(H,28,32)/t15?,18-/m0/s1 |
| InChIKey | CLUGHMFJGKPZCK-PKHIMPSTSA-N |
| XLogP | 2.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|