C16H22F2N4O7S — CID 90243679
(5R)-3-[3,5-difluoro-4-[2-(2-hydroxyethylsulfonyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-[(hydroxyamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 90243679) has the molecular formula C16H22F2N4O7S and a molecular weight of 452.44 g/mol. Its IUPAC name is (5R)-3-[3,5-difluoro-4-[2-(2-hydroxyethylsulfonyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-[(hydroxyamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3,5-difluoro-4-[2-(2-hydroxyethylsulfonyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-[(hydroxyamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90243679 |
| Molecular Formula | C16H22F2N4O7S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (5R)-3-[3,5-difluoro-4-[2-(2-hydroxyethylsulfonyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-[(hydroxyamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CNO)CN1c1cc(F)c(N2CCON(S(=O)(=O)CCO)CC2)c(F)c1 |
| InChI | InChI=1S/C16H22F2N4O7S/c17-13-7-11(21-10-12(9-19-25)29-16(21)24)8-14(18)15(13)20-1-2-22(28-5-3-20)30(26,27)6-4-23/h7-8,12,19,23,25H,1-6,9-10H2/t12-/m0/s1 |
| InChIKey | BKDFPTDJLXVDFN-LBPRGKRZSA-N |
| XLogP | -0.36 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|