C22H22F4N4O6S — CID 158467282
(5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-(2-pyridin-2-ylsulfonyl-1,2,5-oxadiazepan-5-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 158467282) has the molecular formula C22H22F4N4O6S and a molecular weight of 546.50 g/mol. Its IUPAC name is (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-(2-pyridin-2-ylsulfonyl-1,2,5-oxadiazepan-5-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-(2-pyridin-2-ylsulfonyl-1,2,5-oxadiazepan-5-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 158467282 |
| Molecular Formula | C22H22F4N4O6S |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-(2-pyridin-2-ylsulfonyl-1,2,5-oxadiazepan-5-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@H]1CN(c2cc(F)c(N3CCON(S(=O)(=O)c4ccccn4)CC3)c(F)c2)C(=O)O1)C(F)F |
| InChI | InChI=1S/C22H22F4N4O6S/c23-16-11-14(29-13-15(36-22(29)32)4-5-18(31)21(25)26)12-17(24)20(16)28-7-8-30(35-10-9-28)37(33,34)19-3-1-2-6-27-19/h1-3,6,11-12,15,21H,4-5,7-10,13H2/t15-/m0/s1 |
| InChIKey | HFXJAFFNJLOZDX-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 109.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|