C22H22F4N4O6 — CID 161491641
(5S)-3-[3,5-difluoro-4-[2-[2-(1,2-oxazol-3-yl)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 161491641) has the molecular formula C22H22F4N4O6 and a molecular weight of 514.43 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-[2-[2-(1,2-oxazol-3-yl)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-[2-[2-(1,2-oxazol-3-yl)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 161491641 |
| Molecular Formula | C22H22F4N4O6 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-[2-[2-(1,2-oxazol-3-yl)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-5-(4,4-difluoro-3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@H]1CN(c2cc(F)c(N3CCON(C(=O)Cc4ccon4)CC3)c(F)c2)C(=O)O1)C(F)F |
| InChI | InChI=1S/C22H22F4N4O6/c23-16-10-14(29-12-15(36-22(29)33)1-2-18(31)21(25)26)11-17(24)20(16)28-4-5-30(35-8-6-28)19(32)9-13-3-7-34-27-13/h3,7,10-11,15,21H,1-2,4-6,8-9,12H2/t15-/m0/s1 |
| InChIKey | WFRLVTPZLINVTP-HNNXBMFYSA-N |
| XLogP | 2.72 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|