C23H24F4N4O4 — CID 160858608
(5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-[2-(pyridin-2-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 160858608) has the molecular formula C23H24F4N4O4 and a molecular weight of 496.46 g/mol. Its IUPAC name is (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-[2-(pyridin-2-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-[2-(pyridin-2-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 160858608 |
| Molecular Formula | C23H24F4N4O4 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (5S)-5-(4,4-difluoro-3-oxobutyl)-3-[3,5-difluoro-4-[2-(pyridin-2-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@H]1CN(c2cc(F)c(N3CCON(Cc4ccccn4)CC3)c(F)c2)C(=O)O1)C(F)F |
| InChI | InChI=1S/C23H24F4N4O4/c24-18-11-16(31-14-17(35-23(31)33)4-5-20(32)22(26)27)12-19(25)21(18)29-7-8-30(34-10-9-29)13-15-3-1-2-6-28-15/h1-3,6,11-12,17,22H,4-5,7-10,13-14H2/t17-/m0/s1 |
| InChIKey | SKENNPXJIXTJGK-KRWDZBQOSA-N |
| XLogP | 3.55 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|