C19H20F2N4O3S — CID 59531554
(5R)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-(pyridin-2-ylsulfanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 59531554) has the molecular formula C19H20F2N4O3S and a molecular weight of 422.46 g/mol. Its IUPAC name is (5R)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-(pyridin-2-ylsulfanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-(pyridin-2-ylsulfanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59531554 |
| Molecular Formula | C19H20F2N4O3S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (5R)-3-[3,5-difluoro-4-(1,2,5-oxadiazepan-5-yl)phenyl]-5-(pyridin-2-ylsulfanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CSc2ccccn2)CN1c1cc(F)c(N2CCNOCC2)c(F)c1 |
| InChI | InChI=1S/C19H20F2N4O3S/c20-15-9-13(10-16(21)18(15)24-6-5-23-27-8-7-24)25-11-14(28-19(25)26)12-29-17-3-1-2-4-22-17/h1-4,9-10,14,23H,5-8,11-12H2/t14-/m1/s1 |
| InChIKey | PQZRDINUJGMELB-CQSZACIVSA-N |
| XLogP | 2.82 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|