C28H35F2N5O4S — CID 158230420
O-methyl 3-[(5S)-3-[4-[1-[3-[4-(dimethylamino)phenyl]propanoyl]-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate (PubChem CID 158230420) has the molecular formula C28H35F2N5O4S and a molecular weight of 575.68 g/mol. Its IUPAC name is O-methyl 3-[(5S)-3-[4-[1-[3-[4-(dimethylamino)phenyl]propanoyl]-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate.
| Compound Name | O-methyl 3-[(5S)-3-[4-[1-[3-[4-(dimethylamino)phenyl]propanoyl]-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
|---|---|
| PubChem CID | 158230420 |
| Molecular Formula | C28H35F2N5O4S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | O-methyl 3-[(5S)-3-[4-[1-[3-[4-(dimethylamino)phenyl]propanoyl]-1,2,5-triazepan-5-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
| SMILES | COC(=S)CC[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)CCc4ccc(N(C)C)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C28H35F2N5O4S/c1-32(2)20-7-4-19(5-8-20)6-10-25(36)35-15-14-33(13-12-31-35)27-23(29)16-21(17-24(27)30)34-18-22(39-28(34)37)9-11-26(40)38-3/h4-5,7-8,16-17,22,31H,6,9-15,18H2,1-3H3/t22-/m0/s1 |
| InChIKey | GEHTYBRWGKTCPG-QFIPXVFZSA-N |
| XLogP | 3.90 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|