C20H26F2N8O4S — CID 159136912
5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,3,4-thiadiazol-2-yl)-1,2,5-triazepane-1-carboxamide;methane (PubChem CID 159136912) has the molecular formula C20H26F2N8O4S and a molecular weight of 512.54 g/mol. Its IUPAC name is 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,3,4-thiadiazol-2-yl)-1,2,5-triazepane-1-carboxamide;methane.
| Compound Name | 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,3,4-thiadiazol-2-yl)-1,2,5-triazepane-1-carboxamide;methane |
|---|---|
| PubChem CID | 159136912 |
| Molecular Formula | C20H26F2N8O4S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 5-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl]-N-(1,3,4-thiadiazol-2-yl)-1,2,5-triazepane-1-carboxamide;methane |
| SMILES | C.CC(=O)NC[C@H]1CN(c2cc(F)c(N3CCNN(C(=O)Nc4nncs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H22F2N8O4S.CH4/c1-11(30)22-8-13-9-28(19(32)33-13)12-6-14(20)16(15(21)7-12)27-3-2-24-29(5-4-27)18(31)25-17-26-23-10-34-17;/h6-7,10,13,24H,2-5,8-9H2,1H3,(H,22,30)(H,25,26,31);1H4/t13-;/m0./s1 |
| InChIKey | KHPKUBHEVIHXLB-ZOWNYOTGSA-N |
| XLogP | 1.77 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|