C17H25F2N5O3 — CID 70902063
N-[[(5S)-3-[3,5-difluoro-4-[methyl-[2-[methyl(methylamino)amino]ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70902063) has the molecular formula C17H25F2N5O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[[(5S)-3-[3,5-difluoro-4-[methyl-[2-[methyl(methylamino)amino]ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3,5-difluoro-4-[methyl-[2-[methyl(methylamino)amino]ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70902063 |
| Molecular Formula | C17H25F2N5O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[[(5S)-3-[3,5-difluoro-4-[methyl-[2-[methyl(methylamino)amino]ethyl]amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CNN(C)CCN(C)c1c(F)cc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C17H25F2N5O3/c1-11(25)21-9-13-10-24(17(26)27-13)12-7-14(18)16(15(19)8-12)22(3)5-6-23(4)20-2/h7-8,13,20H,5-6,9-10H2,1-4H3,(H,21,25)/t13-/m0/s1 |
| InChIKey | WYEZBEXRHKUUEQ-ZDUSSCGKSA-N |
| XLogP | 0.93 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|