C13H11F5N2O6S — CID 22479574
[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl] trifluoromethanesulfonate (PubChem CID 22479574) has the molecular formula C13H11F5N2O6S and a molecular weight of 418.30 g/mol. Its IUPAC name is [4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22479574 |
| Molecular Formula | C13H11F5N2O6S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2,6-difluorophenyl] trifluoromethanesulfonate |
| SMILES | CC(=O)NCC1CN(c2cc(F)c(OS(=O)(=O)C(F)(F)F)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C13H11F5N2O6S/c1-6(21)19-4-8-5-20(12(22)25-8)7-2-9(14)11(10(15)3-7)26-27(23,24)13(16,17)18/h2-3,8H,4-5H2,1H3,(H,19,21) |
| InChIKey | RSYUUBJWGHHICH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|