C18H25FN4O2 — CID 141498358
(5S)-3-[4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one (PubChem CID 141498358) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is (5S)-3-[4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141498358 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (5S)-3-[4-[(4aR,7aR)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one |
| SMILES | CNC[C@H]1CN(c2ccc(N3C[C@H]4CCCN[C@H]4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H25FN4O2/c1-20-8-14-10-23(18(24)25-14)13-4-5-17(15(19)7-13)22-9-12-3-2-6-21-16(12)11-22/h4-5,7,12,14,16,20-21H,2-3,6,8-11H2,1H3/t12-,14+,16+/m1/s1 |
| InChIKey | QYANGZQTLOOXFK-INWMFGNUSA-N |
| XLogP | 1.56 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|