C20H30FN3O4 — CID 142224197
acetaldehyde;3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;ethanol (PubChem CID 142224197) has the molecular formula C20H30FN3O4 and a molecular weight of 395.48 g/mol. Its IUPAC name is acetaldehyde;3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;ethanol.
| Compound Name | acetaldehyde;3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;ethanol |
|---|---|
| PubChem CID | 142224197 |
| Molecular Formula | C20H30FN3O4 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | acetaldehyde;3-[4-[(5R)-3-azabicyclo[3.1.0]hexan-3-yl]-3-fluorophenyl]-5-(methylaminomethyl)-1,3-oxazolidin-2-one;ethanol |
| SMILES | CC=O.CCO.CNCC1CN(c2ccc(N3CC4C[C@H]4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN3O2.C2H6O.C2H4O/c1-18-6-13-9-20(16(21)22-13)12-2-3-15(14(17)5-12)19-7-10-4-11(10)8-19;2*1-2-3/h2-3,5,10-11,13,18H,4,6-9H2,1H3;3H,2H2,1H3;2H,1H3/t10-,11?,13?;;/m0../s1 |
| InChIKey | OIUOEOKKRYCDAB-UHUGCVDJSA-N |
| XLogP | 2.03 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|