C19H19FN6O3 — CID 173496827
(5R)-3-[3-fluoro-4-(5-hydroxyimino-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 173496827) has the molecular formula C19H19FN6O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-(5-hydroxyimino-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-(5-hydroxyimino-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 173496827 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (5R)-3-[3-fluoro-4-(5-hydroxyimino-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1ccc(N2CC3=CC(=NO)CC3C2)c(F)c1 |
| InChI | InChI=1S/C19H19FN6O3/c20-17-7-15(26-11-16(29-19(26)27)10-25-4-3-21-23-25)1-2-18(17)24-8-12-5-14(22-28)6-13(12)9-24/h1-5,7,13,16,28H,6,8-11H2/t13?,16-/m0/s1 |
| InChIKey | ZGPRWELNSLCYQO-VYIIXAMBSA-N |
| XLogP | 2.04 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|