C22H29FN6O3 — CID 24881596
(5R)-3-[3-fluoro-4-(4-hexanoylpiperazin-1-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 24881596) has the molecular formula C22H29FN6O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-(4-hexanoylpiperazin-1-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-(4-hexanoylpiperazin-1-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24881596 |
| Molecular Formula | C22H29FN6O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (5R)-3-[3-fluoro-4-(4-hexanoylpiperazin-1-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCC(=O)N1CCN(c2ccc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C22H29FN6O3/c1-2-3-4-5-21(30)27-12-10-26(11-13-27)20-7-6-17(14-19(20)23)29-16-18(32-22(29)31)15-28-9-8-24-25-28/h6-9,14,18H,2-5,10-13,15-16H2,1H3/t18-/m0/s1 |
| InChIKey | XUEPOKTYBGGXOG-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|