C21H23FN6O2 — CID 71595486
2-[2-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]acetonitrile (PubChem CID 71595486) has the molecular formula C21H23FN6O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]acetonitrile.
| Compound Name | 2-[2-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 71595486 |
| Molecular Formula | C21H23FN6O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[2-[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]acetonitrile |
| SMILES | N#CCC1CC2CN(c3ccc(N4C[C@H](Cn5ccnn5)OC4=O)cc3F)CC2C1 |
| InChI | InChI=1S/C21H23FN6O2/c22-19-9-17(28-13-18(30-21(28)29)12-27-6-5-24-25-27)1-2-20(19)26-10-15-7-14(3-4-23)8-16(15)11-26/h1-2,5-6,9,14-16,18H,3,7-8,10-13H2/t14?,15?,16?,18-/m0/s1 |
| InChIKey | XJJUKEHEHMBOJK-GUZDXLFXSA-N |
| XLogP | 2.82 |
| TPSA | 87.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|