C24H20ClFN3O3S+ — CID 90904724
(5-chlorothiophen-2-yl)-[[(5R)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-(oxomethylidene)azanium (PubChem CID 90904724) has the molecular formula C24H20ClFN3O3S+ and a molecular weight of 484.96 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[[(5R)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-(oxomethylidene)azanium.
| Compound Name | (5-chlorothiophen-2-yl)-[[(5R)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-(oxomethylidene)azanium |
|---|---|
| PubChem CID | 90904724 |
| Molecular Formula | C24H20ClFN3O3S+ |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[[(5R)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-(oxomethylidene)azanium |
| SMILES | O=C=[N+](C[C@H]1CN(c2ccc(N3CCc4ccccc4C3)c(F)c2)C(=O)O1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C24H20ClFN3O3S/c25-22-7-8-23(33-22)28(15-30)13-19-14-29(24(31)32-19)18-5-6-21(20(26)11-18)27-10-9-16-3-1-2-4-17(16)12-27/h1-8,11,19H,9-10,12-14H2/q+1/t19-/m0/s1 |
| InChIKey | LQPZEAWUFJTBQQ-IBGZPJMESA-N |
| XLogP | 5.11 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|