C11H12FN3O4 — CID 143963568
N'-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-hydroxymethanimidamide (PubChem CID 143963568) has the molecular formula C11H12FN3O4 and a molecular weight of 269.23 g/mol. Its IUPAC name is N'-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 143963568 |
| Molecular Formula | C11H12FN3O4 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N'-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-hydroxymethanimidamide |
| SMILES | O=C1OC(CO)CN1c1ccc(/N=C/NO)c(F)c1 |
| InChI | InChI=1S/C11H12FN3O4/c12-9-3-7(1-2-10(9)13-6-14-18)15-4-8(5-16)19-11(15)17/h1-3,6,8,16,18H,4-5H2,(H,13,14) |
| InChIKey | QBVFSOAJWWAEOZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|