C23H26FN5O4 — CID 147604971
(5S)-3-[3-fluoro-4-[1-(pyridine-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 147604971) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-[1-(pyridine-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-[1-(pyridine-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 147604971 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (5S)-3-[3-fluoro-4-[1-(pyridine-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCNN(C(=O)c4ccccn4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H26FN5O4/c1-16(30)5-7-18-15-28(23(32)33-18)17-6-8-21(19(24)14-17)27-11-10-26-29(13-12-27)22(31)20-4-2-3-9-25-20/h2-4,6,8-9,14,18,26H,5,7,10-13,15H2,1H3/t18-/m0/s1 |
| InChIKey | GAWLPRUCCNMBDA-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|