C23H27FN4O5S — CID 147879889
(5S)-3-[3-fluoro-4-(1-phenylsulfanylperoxy-1,2,5-triazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 147879889) has the molecular formula C23H27FN4O5S and a molecular weight of 490.56 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-(1-phenylsulfanylperoxy-1,2,5-triazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-(1-phenylsulfanylperoxy-1,2,5-triazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 147879889 |
| Molecular Formula | C23H27FN4O5S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (5S)-3-[3-fluoro-4-(1-phenylsulfanylperoxy-1,2,5-triazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCNN(OOSc4ccccc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H27FN4O5S/c1-17(29)7-9-19-16-27(23(30)31-19)18-8-10-22(21(24)15-18)26-12-11-25-28(14-13-26)32-33-34-20-5-3-2-4-6-20/h2-6,8,10,15,19,25H,7,9,11-14,16H2,1H3/t19-/m0/s1 |
| InChIKey | IAFWGMKLIKLFKV-IBGZPJMESA-N |
| XLogP | 3.72 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|