C19H24FN3O4 — CID 69311804
3-[3-[4-(3,3-dimethyl-4-oxopiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide (PubChem CID 69311804) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-[3-[4-(3,3-dimethyl-4-oxopiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide.
| Compound Name | 3-[3-[4-(3,3-dimethyl-4-oxopiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
|---|---|
| PubChem CID | 69311804 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-[3-[4-(3,3-dimethyl-4-oxopiperidin-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
| SMILES | CC1(C)CN(c2ccc(N3CC(CCC(N)=O)OC3=O)cc2F)CCC1=O |
| InChI | InChI=1S/C19H24FN3O4/c1-19(2)11-22(8-7-16(19)24)15-5-3-12(9-14(15)20)23-10-13(27-18(23)26)4-6-17(21)25/h3,5,9,13H,4,6-8,10-11H2,1-2H3,(H2,21,25) |
| InChIKey | JADYYMXWGGCPLX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|