C23H25FN2O6 — CID 148813347
(5S)-5-[4-(2,3-dihydroxyphenyl)-3-oxobutyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 148813347) has the molecular formula C23H25FN2O6 and a molecular weight of 444.46 g/mol. Its IUPAC name is (5S)-5-[4-(2,3-dihydroxyphenyl)-3-oxobutyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-[4-(2,3-dihydroxyphenyl)-3-oxobutyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 148813347 |
| Molecular Formula | C23H25FN2O6 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (5S)-5-[4-(2,3-dihydroxyphenyl)-3-oxobutyl]-3-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1)Cc1cccc(O)c1O |
| InChI | InChI=1S/C23H25FN2O6/c24-19-13-16(4-7-20(19)25-8-10-31-11-9-25)26-14-18(32-23(26)30)6-5-17(27)12-15-2-1-3-21(28)22(15)29/h1-4,7,13,18,28-29H,5-6,8-12,14H2/t18-/m0/s1 |
| InChIKey | OQIVTQBGCMJYPX-SFHVURJKSA-N |
| XLogP | 2.99 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|