C24H25FN6O5S — CID 146926195
O-methyl 3-[(5S)-3-[4-(1,3-dioxo-2-pyridin-4-yl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepin-7-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate (PubChem CID 146926195) has the molecular formula C24H25FN6O5S and a molecular weight of 528.57 g/mol. Its IUPAC name is O-methyl 3-[(5S)-3-[4-(1,3-dioxo-2-pyridin-4-yl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepin-7-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate.
| Compound Name | O-methyl 3-[(5S)-3-[4-(1,3-dioxo-2-pyridin-4-yl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepin-7-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
|---|---|
| PubChem CID | 146926195 |
| Molecular Formula | C24H25FN6O5S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | O-methyl 3-[(5S)-3-[4-(1,3-dioxo-2-pyridin-4-yl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,5]triazepin-7-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
| SMILES | COC(=S)CC[C@H]1CN(c2ccc(N3CCn4c(=O)n(-c5ccncc5)c(=O)n4CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H25FN6O5S/c1-35-21(37)5-3-18-15-28(24(34)36-18)17-2-4-20(19(25)14-17)27-10-12-29-22(32)31(16-6-8-26-9-7-16)23(33)30(29)13-11-27/h2,4,6-9,14,18H,3,5,10-13,15H2,1H3/t18-/m0/s1 |
| InChIKey | AECWVQPFPNWSEK-SFHVURJKSA-N |
| XLogP | 1.93 |
| TPSA | 103.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|