C23H24FN5O4S — CID 162257180
O-methyl 3-[(5S)-3-[3-fluoro-4-(8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-12-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate (PubChem CID 162257180) has the molecular formula C23H24FN5O4S and a molecular weight of 485.54 g/mol. Its IUPAC name is O-methyl 3-[(5S)-3-[3-fluoro-4-(8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-12-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate.
| Compound Name | O-methyl 3-[(5S)-3-[3-fluoro-4-(8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-12-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
|---|---|
| PubChem CID | 162257180 |
| Molecular Formula | C23H24FN5O4S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | O-methyl 3-[(5S)-3-[3-fluoro-4-(8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-12-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]propanethioate |
| SMILES | COC(=S)CC[C@H]1CN(c2ccc(N3CCn4c(=O)c5cccnc5n4CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H24FN5O4S/c1-32-20(34)7-5-16-14-27(23(31)33-16)15-4-6-19(18(24)13-15)26-9-11-28-21-17(3-2-8-25-21)22(30)29(28)12-10-26/h2-4,6,8,13,16H,5,7,9-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | ZYTCLEDCOPRPIB-INIZCTEOSA-N |
| XLogP | 2.94 |
| TPSA | 81.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|