C24H26FN7O6S — CID 25253623
methyl N-[12-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-5-yl]carbamate (PubChem CID 25253623) has the molecular formula C24H26FN7O6S and a molecular weight of 559.58 g/mol. Its IUPAC name is methyl N-[12-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-5-yl]carbamate.
| Compound Name | methyl N-[12-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-5-yl]carbamate |
|---|---|
| PubChem CID | 25253623 |
| Molecular Formula | C24H26FN7O6S |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | methyl N-[12-[2-fluoro-4-[(5S)-5-[(methoxycarbothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]-8-oxo-1,3,9,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-trien-5-yl]carbamate |
| SMILES | COC(=O)Nc1cnc2c(c1)c(=O)n1n2CCN(c2ccc(N3C[C@H](CNC(=S)OC)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C24H26FN7O6S/c1-36-22(34)28-14-9-17-20(26-11-14)31-7-5-29(6-8-32(31)21(17)33)19-4-3-15(10-18(19)25)30-13-16(38-24(30)35)12-27-23(39)37-2/h3-4,9-11,16H,5-8,12-13H2,1-2H3,(H,27,39)(H,28,34)/t16-/m0/s1 |
| InChIKey | AHJVRRXXCAGFKY-INIZCTEOSA-N |
| XLogP | 1.88 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|