C22H33FN4O11P2 — CID 25029914
[5-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbonyl]oxy-1-phosphonopentyl]phosphonic acid (PubChem CID 25029914) has the molecular formula C22H33FN4O11P2 and a molecular weight of 610.47 g/mol. Its IUPAC name is [5-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbonyl]oxy-1-phosphonopentyl]phosphonic acid.
| Compound Name | [5-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbonyl]oxy-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 25029914 |
| Molecular Formula | C22H33FN4O11P2 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | [5-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbonyl]oxy-1-phosphonopentyl]phosphonic acid |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)OCCCCC(P(=O)(O)O)P(=O)(O)O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H33FN4O11P2/c1-15(28)24-13-17-14-27(22(30)38-17)16-5-6-19(18(23)12-16)25-7-9-26(10-8-25)21(29)37-11-3-2-4-20(39(31,32)33)40(34,35)36/h5-6,12,17,20H,2-4,7-11,13-14H2,1H3,(H,24,28)(H2,31,32,33)(H2,34,35,36)/t17-/m0/s1 |
| InChIKey | GRIHRBBPKQSRGL-KRWDZBQOSA-N |
| XLogP | 1.40 |
| TPSA | 206.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|