C21H26Cl2FN3O5 — CID 68697560
2,2-dichloro-N-[[3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 68697560) has the molecular formula C21H26Cl2FN3O5 and a molecular weight of 490.36 g/mol. Its IUPAC name is 2,2-dichloro-N-[[3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 68697560 |
| Molecular Formula | C21H26Cl2FN3O5 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 2,2-dichloro-N-[[3-[4-(6,6-dimethyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC1(C)CN(c2ccc(N3CC(CNC(=O)C(Cl)Cl)OC3=O)cc2F)CCC12OCCO2 |
| InChI | InChI=1S/C21H26Cl2FN3O5/c1-20(2)12-26(6-5-21(20)30-7-8-31-21)16-4-3-13(9-15(16)24)27-11-14(32-19(27)29)10-25-18(28)17(22)23/h3-4,9,14,17H,5-8,10-12H2,1-2H3,(H,25,28) |
| InChIKey | VPBKOGRLJODIFX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|