C13H14N2O7S — CID 87130130
[(5S)-2-oxo-3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 87130130) has the molecular formula C13H14N2O7S and a molecular weight of 342.33 g/mol. Its IUPAC name is [(5S)-2-oxo-3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5S)-2-oxo-3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87130130 |
| Molecular Formula | C13H14N2O7S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | [(5S)-2-oxo-3-(3-oxo-4H-1,4-benzoxazin-6-yl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1CN(c2ccc3c(c2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C13H14N2O7S/c1-23(18,19)21-6-9-5-15(13(17)22-9)8-2-3-11-10(4-8)14-12(16)7-20-11/h2-4,9H,5-7H2,1H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | UZVVPQKUSXFAAH-VIFPVBQESA-N |
| XLogP | 0.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|