C14H17N3O7S — CID 90216333
3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl methanesulfonate (PubChem CID 90216333) has the molecular formula C14H17N3O7S and a molecular weight of 371.37 g/mol. Its IUPAC name is 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl methanesulfonate.
| Compound Name | 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 90216333 |
| Molecular Formula | C14H17N3O7S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC[C@H]1CN(c2ccc3c(n2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C14H17N3O7S/c1-25(20,21)23-6-2-3-9-7-17(14(19)24-9)11-5-4-10-13(15-11)16-12(18)8-22-10/h4-5,9H,2-3,6-8H2,1H3,(H,15,16,18)/t9-/m0/s1 |
| InChIKey | TZOOKFCPIOBJKM-VIFPVBQESA-N |
| XLogP | 0.49 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|