C20H20ClN5O5 — CID 90216269
2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide (PubChem CID 90216269) has the molecular formula C20H20ClN5O5 and a molecular weight of 445.86 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide.
| Compound Name | 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide |
|---|---|
| PubChem CID | 90216269 |
| Molecular Formula | C20H20ClN5O5 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-amino-6-chloro-N-[3-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]benzamide |
| SMILES | Nc1cccc(Cl)c1C(=O)NCCCC1CN(c2ccc3c(n2)NC(=O)CO3)C(=O)O1 |
| InChI | InChI=1S/C20H20ClN5O5/c21-12-4-1-5-13(22)17(12)19(28)23-8-2-3-11-9-26(20(29)31-11)15-7-6-14-18(24-15)25-16(27)10-30-14/h1,4-7,11H,2-3,8-10,22H2,(H,23,28)(H,24,25,27) |
| InChIKey | JVUYYICMUDRVLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|