C22H21N5O6 — CID 156862197
2-[2-[2-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]ethyl]isoindole-1,3-dione (PubChem CID 156862197) has the molecular formula C22H21N5O6 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[2-[2-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 156862197 |
| Molecular Formula | C22H21N5O6 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[2-[2-[2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]ethyl]isoindole-1,3-dione |
| SMILES | O=C1COc2ccc(N3CC(CCNCCN4C(=O)c5ccccc5C4=O)OC3=O)nc2N1 |
| InChI | InChI=1S/C22H21N5O6/c28-18-12-32-16-5-6-17(24-19(16)25-18)27-11-13(33-22(27)31)7-8-23-9-10-26-20(29)14-3-1-2-4-15(14)21(26)30/h1-6,13,23H,7-12H2,(H,24,25,28) |
| InChIKey | BXHWAZNVYCVCTH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|