C30H33N5O7 — CID 118938923
6-[(5S)-5-[2-[[3-[6-[[(3S,4R)-3,4-dihydroxycyclopentyl]methoxy]-2-pyridinyl]phenyl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 118938923) has the molecular formula C30H33N5O7 and a molecular weight of 575.62 g/mol. Its IUPAC name is 6-[(5S)-5-[2-[[3-[6-[[(3S,4R)-3,4-dihydroxycyclopentyl]methoxy]-2-pyridinyl]phenyl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[(5S)-5-[2-[[3-[6-[[(3S,4R)-3,4-dihydroxycyclopentyl]methoxy]-2-pyridinyl]phenyl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 118938923 |
| Molecular Formula | C30H33N5O7 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 6-[(5S)-5-[2-[[3-[6-[[(3S,4R)-3,4-dihydroxycyclopentyl]methoxy]-2-pyridinyl]phenyl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ccc(N3C[C@H](CCNCc4cccc(-c5cccc(OCC6C[C@@H](O)[C@@H](O)C6)n5)c4)OC3=O)nc2N1 |
| InChI | InChI=1S/C30H33N5O7/c36-23-12-19(13-24(23)37)16-41-28-6-2-5-22(32-28)20-4-1-3-18(11-20)14-31-10-9-21-15-35(30(39)42-21)26-8-7-25-29(33-26)34-27(38)17-40-25/h1-8,11,19,21,23-24,31,36-37H,9-10,12-17H2,(H,33,34,38)/t19?,21-,23-,24+/m0/s1 |
| InChIKey | SGPBCLMUTTUENH-DJTAZZKNSA-N |
| XLogP | 2.49 |
| TPSA | 155.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|