C35H41N5O7 — CID 140815255
tert-butyl N-[(1R,3R)-3-[3-[3-[[2-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]phenyl]phenoxy]cyclopentyl]carbamate (PubChem CID 140815255) has the molecular formula C35H41N5O7 and a molecular weight of 643.74 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R)-3-[3-[3-[[2-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]phenyl]phenoxy]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R)-3-[3-[3-[[2-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]phenyl]phenoxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 140815255 |
| Molecular Formula | C35H41N5O7 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | tert-butyl N-[(1R,3R)-3-[3-[3-[[2-[(5S)-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]phenyl]phenoxy]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](Oc2cccc(-c3cccc(CNCC[C@H]4CN(c5ccc6c(n5)NC(=O)CO6)C(=O)O4)c3)c2)C1 |
| InChI | InChI=1S/C35H41N5O7/c1-35(2,3)47-33(42)37-25-10-11-27(18-25)45-26-9-5-8-24(17-26)23-7-4-6-22(16-23)19-36-15-14-28-20-40(34(43)46-28)30-13-12-29-32(38-30)39-31(41)21-44-29/h4-9,12-13,16-17,25,27-28,36H,10-11,14-15,18-21H2,1-3H3,(H,37,42)(H,38,39,41)/t25-,27-,28+/m1/s1 |
| InChIKey | MMFNENJFXSSIDV-KZQOYIJHSA-N |
| XLogP | 5.41 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|