C13H15N3O5S — CID 87822785
[(5R)-3-(1-methylindazol-5-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 87822785) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is [(5R)-3-(1-methylindazol-5-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5R)-3-(1-methylindazol-5-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87822785 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [(5R)-3-(1-methylindazol-5-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | Cn1ncc2cc(N3C[C@H](COS(C)(=O)=O)OC3=O)ccc21 |
| InChI | InChI=1S/C13H15N3O5S/c1-15-12-4-3-10(5-9(12)6-14-15)16-7-11(21-13(16)17)8-20-22(2,18)19/h3-6,11H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | DQUQAHSCGOTSLW-LLVKDONJSA-N |
| XLogP | 0.87 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|